| Name |
25-O-Methylcimigenol O-Methylcimigenol |
| Formula |
C31H50O5 |
| Mw |
502.36582471 |
| CAS RN |
20528-90-9 |
| C_ID |
C00050666
|
| InChIKey |
ZBGCVOZXXHKPFL-NOWJNILLNA-N |
| InChICode |
InChI=1S/C31H50O5/c1-17-15-18-23(26(4,5)34-8)36-31(35-18)22(17)27(6)13-14-30-16-29(30)12-11-21(32)25(2,3)19(29)9-10-20(30)28(27,7)24(31)33/h17-24,32-33H,9-16H2,1-8H3/t17-,18-,19+,20+,21+,22-,23+,24-,27-,28-,29-,30+,31+/m1/s1 |
| SMILES |
COC(C)(C)[C@H]1OC23O[C@@H]1C[C@@H](C)[C@@H]2[C@@]1(C)CC[C@@]24C[C@@]25CC[C@H](O)C(C)(C)[C@@H]5CC[C@H]4[C@]1(C)[C@H]3O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Cimicifuga acerina | Ref. |
| Plantae | Ranunculaceae | Cimicifuga simplex  | Ref. |
|
|
zoom in
| Organism | Cimicifuga simplex | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
lin, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 14, (2002), 58 |
|---|
|