| Name |
Flavaspidic acid BB |
| Formula |
C24H30O8 |
| Mw |
446.19406794 |
| CAS RN |
114-42-1 |
| C_ID |
C00050591
|
| InChIKey |
HNAIAJNEQWTLNE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C24H30O8/c1-6-8-14(25)16-19(28)11(3)18(27)12(20(16)29)10-13-21(30)17(15(26)9-7-2)23(32)24(4,5)22(13)31/h27-29,31-32H,6-10H2,1-5H3 |
| SMILES |
CCCC(=O)C1=C(O)C(C)(C)C(O)=C(Cc2c(O)c(C)c(O)c(C(=O)CCC)c2O)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dryopteridaceae | Dryopteris caucasica | Ref. |
| Plantae | Dryopteridaceae | Dryopteris chrysocoma | Ref. |
| Plantae | Dryopteridaceae | Dryopteris filix-mas. | Ref. |
|
|
zoom in
| Organism | Dryopteris chrysocoma | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|