| Name |
Crenatoside |
| Formula |
C30H28O11 |
| Mw |
564.16316174 |
| CAS RN |
948313-84-6 |
| C_ID |
C00050565
|
| InChIKey |
YIVJHIINQZUPTD-JZJUYLCRSA-N |
| InChICode |
InChI=1S/C30H28O11/c1-14-9-17-11-19(12-21(33)25(17)29-24(14)20(32)10-15(2)39-29)40-30-28(37)27(36)26(35)22(41-30)13-38-23(34)8-5-16-3-6-18(31)7-4-16/h3-12,22,26-28,30-31,33,35-37H,13H2,1-2H3/b8-5+/t22-,26-,27+,28-,30-/m1/s1 |
| SMILES |
Cc1cc(=O)c2c(C)cc3cc(O[C@@H]4O[C@H](COC(=O)/C=C/c5ccc(O)cc5)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c3c2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Microtoena prainiana | Ref. |
| Plantae | Orobanchaceae | Cistanche tubulosa  | Ref. |
| Plantae | Orobanchaceae | Orobanche coerulescens  | Ref. |
|
|
zoom in
| Organism | Cistanche tubulosa | | Reference | Lin, et al., Planta Med, 70, (2004), 50.
Li, et al., Journal of Natural Products, 67, (2004), 978.
Lei, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 34, (2003), 473. |
|---|
|