| Name |
Benzyl 2,6-dimethoxybenzoate |
| Formula |
C16H16O4 |
| Mw |
272.104859 |
| CAS RN |
34328-54-6 |
| C_ID |
C00050540
|
| InChIKey |
PKIYLOACOOWBCU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H16O4/c1-18-13-9-6-10-14(19-2)15(13)16(17)20-11-12-7-4-3-5-8-12/h3-10H,11H2,1-2H3 |
| SMILES |
COc1cccc(OC)c1C(=O)OCc1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| - | - | Solidigo virgaurea var.leiocarpa | Ref. |
|
|
zoom in
| Organism | Solidigo virgaurea var.leiocarpa | | Reference | Ragasa, et al., Journal of Natural Products, 65, (2002), 1107.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999). |
|---|
|