| Name |
2-Methoxy-1,4-naphthoquinone 2-Methoxynaphthoquinone |
| Formula |
C11H8O3 |
| Mw |
188.04734412 |
| CAS RN |
2348-82-5 |
| C_ID |
C00049940
, 
|
| InChIKey |
OBGBGHKYJAOXRR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H8O3/c1-14-10-6-9(12)7-4-2-3-5-8(7)11(10)13/h2-6H,1H3 |
| SMILES |
COC1=CC(=O)c2ccccc2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Balsaminaceae | Impatiens balsamina  | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|