| Name |
Hainanolidol |
| Formula |
C19H20O4 |
| Mw |
312.13615913 |
| CAS RN |
73213-63-5 |
| C_ID |
C00049722
, 
|
| InChIKey |
XGXBIRLBBHSIBS-LQDNJBGSNA-N |
| InChICode |
InChI=1S/C19H20O4/c1-8-5-11(20)6-10-3-4-19-9(2)16(21)17(23-18(19)22)13-7-12(8)14(10)15(13)19/h5-6,9,13,15-17,21H,3-4,7H2,1-2H3/t9-,13+,15+,16-,17-,19-/m1/s1 |
| SMILES |
Cc1cc(=O)cc2c3c1C[C@@H]1[C@H]4OC(=O)[C@](CC2)([C@H](C)[C@H]4O)[C@H]31 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus fortunei | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia | Ref. |
|
|
zoom in
| Organism | Cephalotaxus harringtonia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|