| Name |
Higenamine |
| Formula |
C16H17NO3 |
| Mw |
271.12084342 |
| CAS RN |
5843-65-2 |
| C_ID |
C00049556
, 
|
| InChIKey |
WZRCQWQRFZITDX-YQTOOIBONA-N |
| InChICode |
InChI=1S/C16H17NO3/c18-12-3-1-10(2-4-12)7-14-13-9-16(20)15(19)8-11(13)5-6-17-14/h1-4,8-9,14,17-20H,5-7H2/t14-/m1/s1 |
| SMILES |
Oc1ccc(C[C@H]2NCCc3cc(O)c(O)cc32)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gnetaceae | Gnetum parvifolium  | Ref. |
| Plantae | Menispermaceae | Tinospora crispa  | Ref. |
| Plantae | Ranunculaceae | Aconitum japonicum Thunb. | Ref. |
|
|
zoom in
| Organism | Tinospora crispa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|