| Name |
Ajugin B (+)-Ajugin B |
| Formula |
C28H40O6 |
| Mw |
472.28248901 |
| CAS RN |
245352-31-2 |
| C_ID |
C00049421
, 
|
| InChIKey |
QKPKTUVZMMGWLF-VEZSUABGNA-N |
| InChICode |
InChI=1S/C28H40O6/c1-16-14-23(34-24(31)18(16)15-29)27(4,32)21-11-13-28(33)20-9-8-17-6-5-7-22(30)26(17,3)19(20)10-12-25(21,28)2/h8,19-21,23,29,32-33H,5-7,9-15H2,1-4H3/t19-,20+,21-,23+,25+,26-,27+,28+/m0/s1 |
| SMILES |
CC1=C(CO)C(=O)O[C@@H]([C@](C)(O)[C@H]2CC[C@@]3(O)[C@@H]4CC=C5CCCC(=O)[C@]5(C)[C@H]4CC[C@]23C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Ajuga parviflora | Ref. |
| Plantae | Solanaceae | Withania coagulans  | Ref. |
|
|
zoom in
| Organism | Withania coagulans | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|