| Name |
Acetyl-beta-sitosterol beta-Sitosterol acetate |
| Formula |
C31H52O2 |
| Mw |
456.3967309 |
| CAS RN |
915-05-9 |
| C_ID |
C00049121
, 
|
| InChIKey |
PBWOIPCULUXTNY-JCHLCHBENA-N |
| InChICode |
InChI=1S/C31H52O2/c1-8-23(20(2)3)10-9-21(4)27-13-14-28-26-12-11-24-19-25(33-22(5)32)15-17-30(24,6)29(26)16-18-31(27,28)7/h11,20-21,23,25-29H,8-10,12-19H2,1-7H3/t21-,23-,25+,26+,27-,28+,29+,30+,31-/m1/s1 |
| SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia leucophloea  | Ref. |
| Plantae | Fabaceae | Cassia nigricans  | Ref. |
| Plantae | Meliaceae | Ekebergia pterophylla | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Cassia nigricans | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|