| Name |
10-Hydroxyligstroside (-)-10-Hydroxyligstroside 10-Hydroxyligustroside |
| Formula |
C25H32O13 |
| Mw |
540.18429111 |
| CAS RN |
35897-94-0 |
| C_ID |
C00049064
, 
|
| InChIKey |
AHTRGGWSBFOEEG-JUGUOOORNA-N |
| InChICode |
InChI=1S/C25H32O13/c1-34-23(33)17-12-36-24(38-25-22(32)21(31)20(30)18(11-27)37-25)15(6-8-26)16(17)10-19(29)35-9-7-13-2-4-14(28)5-3-13/h2-6,12,16,18,20-22,24-28,30-32H,7-11H2,1H3/b15-6+/t16-,18+,20+,21-,22+,24-,25-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)/C(=C/CO)[C@@H]1CC(=O)OCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Jasminum multiflorum  | Ref. |
|
|
zoom in
| Organism | Jasminum multiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|