| Name |
Selina-3,7-diene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
10064-34-3 |
| C_ID |
C00048532
, 
|
| InChIKey |
SWCOCRTVQQHGKB-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6-7,11,14H,5,8-10H2,1-4H3/t14-,15+/m0/s1 |
| SMILES |
CC1=CCC[C@]2(C)CC=C(C(C)C)C[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
| Organism | Zingiber officinale |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
