| Name |
Isoindigo |
| Formula |
C16H10N2O2 |
| Mw |
262.07422758 |
| CAS RN |
476-34-6 |
| C_ID |
C00048436
, 
|
| InChIKey |
MLCPSWPIYHDOKG-BUHFOSPRSA-N |
| InChICode |
InChI=1S/C16H10N2O2/c19-15-13(9-5-1-3-7-11(9)17-15)14-10-6-2-4-8-12(10)18-16(14)20/h1-8H,(H,17,19)(H,18,20)/b14-13+ |
| SMILES |
O=C1Nc2ccccc2/C1=C1C(=O)Nc2ccccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| - | - | Baphicacanthus cusia | Ref. |
|
|
zoom in
| Organism | Baphicacanthus cusia |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (selection version), Shanghai Science and technology Press, Shanghai, (1998).
Leclerc, et al., J. Biol. Chem., 276, (2001), 25 |
|---|
|
