| Name |
Benzyl tiglate |
| Formula |
C12H14O2 |
| Mw |
190.09937969 |
| CAS RN |
37526-88-8 |
| C_ID |
C00048327
, 
|
| InChIKey |
QRGSTISKDZCDHV-XCVCLJGOSA-N |
| InChICode |
InChI=1S/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+ |
| SMILES |
C/C=C(C)C(=O)OCc1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| - | - | Proteaceae | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|