| Name |
Akhdarenol |
| Formula |
C20H32O |
| Mw |
288.24531564 |
| CAS RN |
83692-05-1 |
| C_ID |
C00048309
, 
|
| InChIKey |
DUEINKIQNGZKPL-QYUGEJKSNA-N |
| InChICode |
InChI=1S/C20H32O/c1-5-18(2)12-9-16-15(13-18)7-8-17-19(3,14-21)10-6-11-20(16,17)4/h5,7,16-17,21H,1,6,8-14H2,2-4H3/t16-,17-,18-,19+,20+/m0/s1 |
| SMILES |
C=C[C@@]1(C)CC[C@H]2C(=CC[C@H]3[C@@](C)(CO)CCC[C@]23C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Aeollanthus rydingianus | Ref. |
| Plantae | Labiatae | Origanum akhdarense | Ref. |
|
|
zoom in
| Organism | Origanum akhdarense |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
