| Name |
Isoobtusilactone A |
| Formula |
C19H32O3 |
| Mw |
308.23514489 |
| CAS RN |
56522-16-8 |
| C_ID |
C00047930
, 
|
| InChIKey |
FCLYKYQBTSMTJB-UWWLZDFINA-N |
| InChICode |
InChI=1S/C19H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-18(20)16(2)22-19(17)21/h15,18,20H,2-14H2,1H3/b17-15+/t18-/m1/s1 |
| SMILES |
C=C1OC(=O)/C(=C/CCCCCCCCCCCCC)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Cinnamomum tenuifolium | Ref. |
| Plantae | Lauraceae | Lindera obtusiloba | Ref. |
| Plantae | Lauraceae | Persea borbonia | Ref. |
| Plantae | Lauraceae | Persea spp. | Ref. |
|
|
zoom in
| Organism | Lindera obtusiloba | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|