| Name |
Alstoyunine F (-)-Alstoyunine F |
| Formula |
C22H26N2O4 |
| Mw |
382.18925733 |
| CAS RN |
1188932-16-2 |
| C_ID |
C00047712
, 
|
| InChIKey |
XHABFDBTVXEZFH-ZDKMLSRYNA-N |
| InChICode |
InChI=1S/C22H26N2O4/c1-10(27-3)17-12-8-15-19-22(13-6-4-5-7-14(13)23-19)9-16(24(15)21(17)26)18(12)20(22)28-11(2)25/h4-7,10,12,15-18,20-21,26H,8-9H2,1-3H3/t10-,12+,15+,16+,17+,18+,20-,21-,22-/m1/s1 |
| SMILES |
COC(C)[C@H]1C2C[C@H]3C4=Nc5ccccc5C45C[C@@H](C2[C@H]5OC(C)=O)N3[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Alstonia yunnanensis | Ref. |
| Plantae | Apocynaceae | Rauwolfia verticillata | Ref. |
|
|
zoom in
| Organism | Rauwolfia verticillata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|