| Name |
Androsta-1,4-diene-3,17-dione (+)-Androsta-1,4-diene-3,17-dione |
| Formula |
C19H24O2 |
| Mw |
284.17763001 |
| CAS RN |
897-06-3 |
| C_ID |
C00047005
, 
|
| InChIKey |
LUJVUUWNAPIQQI-VTJZKLMFNA-N |
| InChICode |
InChI=1S/C19H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-16H,3-6,8,10H2,1-2H3/t14-,15-,16-,18+,19-/m0/s1 |
| SMILES |
C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Meliaceae | Aglaia rubiginosa | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
|
|
zoom in
| Organism | Plumbago zeylanica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|