| Name |
Punicafolin |
| Formula |
C41H30O26 |
| Mw |
938.10253114 |
| CAS RN |
88847-11-4 |
| C_ID |
C00046334
, 
|
| InChIKey |
DPBVYZVSXAZMAY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)64-33-23-9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(8-22(49)30(54)32(25)56)40(61)65-34(33)35(66-37(58)11-3-17(44)27(51)18(45)4-11)41(63-23)67-38(59)12-5-19(46)28(52)20(47)6-12/h1-8,23,33-35,41-56H,9H2/t23-,33-,34+,35+,41+/m0/s1 |
| SMILES |
O=C(OC1OC2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)OC(C2OC(=O)c2cc(O)c(O)c(O)c2)C1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
| Plantae | Euphorbiaceae | Mallotus japonicus  | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
|
|
zoom in
| Organism | Mallotus japonicus | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Zhang, et al., JNP, 64, (2001), 1527 |
|---|
|