| Name |
Prinoidin |
| Formula |
C25H26O10 |
| Mw |
486.15259705 |
| CAS RN |
118985-30-1 |
| C_ID |
C00046328
, 
|
| InChIKey |
DARHCWIFQPMQTB-MDBJNBSKNA-N |
| InChICode |
InChI=1S/C25H26O10/c1-10-5-14-7-15-8-16(9-18(29)20(15)22(31)19(14)17(28)6-10)35-25-24(34-13(4)27)23(33-12(3)26)21(30)11(2)32-25/h5-6,8-9,11,21,23-25,28-30H,7H2,1-4H3/t11-,21-,23+,24+,25-/m0/s1 |
| SMILES |
CC(=O)O[C@@H]1[C@@H](O)[C@H](C)O[C@@H](Oc2cc(O)c3c(c2)Cc2cc(C)cc(O)c2C3=O)[C@@H]1OC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Rhamnus nepalensis | Ref. |
| Plantae | Rhamnaceae | Rhamnus prinoides  | Ref. |
|
|
zoom in
| Organism | Rhamnus prinoides |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
