| Name |
Arjunic acid |
| Formula |
C30H48O5 |
| Mw |
488.35017464 |
| CAS RN |
31298-06-3 |
| C_ID |
C00045663
, 
|
| InChIKey |
XJMYUPJDAFKICJ-BIJFZNPXNA-N |
| InChICode |
InChI=1S/C30H48O5/c1-25(2)12-14-30(24(34)35)15-13-28(6)17(21(30)23(25)33)8-9-20-27(5)16-18(31)22(32)26(3,4)19(27)10-11-29(20,28)7/h8,18-23,31-33H,9-16H2,1-7H3,(H,34,35)/t18-,19+,20-,21-,22+,23+,27+,28-,29-,30+/m1/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Combretaceae | Terminalia arjuna  | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
|
|
zoom in
| Organism | Terminalia arjuna | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|