| Name |
Vidalenolone |
| Formula |
C13H14O4 |
| Mw |
234.08920894 |
| CAS RN |
398475-98-4 |
| C_ID |
C00045437
, 
|
| InChIKey |
UJDWQMHSONZRPQ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C13H14O4/c1-17-13(7-6-11(15)12(13)16)8-9-2-4-10(14)5-3-9/h2-6,14-15H,7-8H2,1H3/t13-/m0/s1 |
| SMILES |
COC1(Cc2ccc(O)cc2)CC=C(O)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Tephritidae | Vidalia sp. | Ref. |
| Plantae | Fabaceae | Cassia angustifolia  | Ref. |
|
|
zoom in
| Organism | Cassia angustifolia |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
