| Name |
Diasesartemin |
| Formula |
C23H26O8 |
| Mw |
430.16276781 |
| CAS RN |
77449-33-3 |
| C_ID |
C00045293
, 
|
| InChIKey |
DHWUVPPRBIJJKS-HSCCPOAHNA-N |
| InChICode |
InChI=1S/C23H26O8/c1-24-16-5-12(6-17(25-2)22(16)27-4)20-14-9-29-21(15(14)10-28-20)13-7-18(26-3)23-19(8-13)30-11-31-23/h5-8,14-15,20-21H,9-11H2,1-4H3/t14-,15-,20-,21-/m0/s1 |
| SMILES |
COc1cc([C@@H]2OC[C@H]3[C@@H]2CO[C@H]3c2cc(OC)c3c(c2)OCO3)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia absinthium  | Ref. |
| Plantae | Burseraceae | Commiphora wightii  | Ref. |
| Plantae | Hernandiaceae | Hernandia ovigera  | Ref. |
|
|
zoom in
| Organism | Commiphora wightii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|