| Name |
Zizyvoside I |
| Formula |
C25H40O12 |
| Mw |
532.25197674 |
| CAS RN |
81425-28-7 |
| C_ID |
C00045143
, 
|
| InChIKey |
SWOFNYOUVWQWHE-RUROELMINA-N |
| InChICode |
InChI=1S/C25H40O12/c1-11-8-14(27)9-24(4,5)25(11,33)7-6-12(2)34-23-21(19(31)17(29)15(10-26)36-23)37-22-20(32)18(30)16(28)13(3)35-22/h6-8,12-13,15-23,26,28-33H,9-10H2,1-5H3/b7-6+/t12-,13+,15-,16+,17-,18-,19+,20-,21-,22+,23-,25-/m1/s1 |
| SMILES |
CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/[C@@H](C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dioscoreaceae | Dioscorea spongiosa | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba var.inermis  | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba var.inermis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Yin, et al., JNP, 66, (2003), 646 |
|---|
|