| Name |
Torreyayunnin (+)-Torreyayunnin |
| Formula |
C20H26O4 |
| Mw |
330.18310932 |
| CAS RN |
583861-71-6 |
| C_ID |
C00045113
, 
|
| InChIKey |
WDKBIUNFLNEEEH-DZLYFNQKNA-N |
| InChICode |
InChI=1S/C20H26O4/c1-10(2)11-8-12-13(21)9-14-19(3,4)15(22)6-7-20(14,5)16(12)18(24)17(11)23/h8,10,14,23-24H,6-7,9H2,1-5H3/t14-,20+/m1/s1 |
| SMILES |
CC(C)c1cc2c(c(O)c1O)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Amentotaxus yunnanensis | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus lanceolata | Ref. |
| Plantae | Taxaceae | Torreya yunnanensis | Ref. |
|
|
zoom in
| Organism | Cephalotaxus lanceolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|