| Name |
Torachrysone-8-O-beta-D-glucopyranoside Torachrysone 8-O-beta-D-glucoside |
| Formula |
C20H24O9 |
| Mw |
408.14203237 |
| CAS RN |
64032-49-1 |
| C_ID |
C00045112
, 
|
| InChIKey |
GHKWPHRULCFTBB-LGGHGDSLNA-N |
| InChICode |
InChI=1S/C20H24O9/c1-8-4-10-5-11(27-3)6-12(15(10)17(24)14(8)9(2)22)28-20-19(26)18(25)16(23)13(7-21)29-20/h4-6,13,16,18-21,23-26H,7H2,1-3H3/t13-,16-,18+,19-,20-/m1/s1 |
| SMILES |
COc1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2c(O)c(C(C)=O)c(C)cc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Rheum emodi  | Ref. |
| Plantae | Polygonaceae | Rumex patientia  | Ref. |
| - | - | Rhei rhizoma  | Ref. |
|
|
zoom in
| Organism | Rumex patientia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|