| Name |
Philadelphicalactone A (-)-Philadelphicalactone A |
| Formula |
C28H40O7 |
| Mw |
488.27740363 |
| CAS RN |
444588-47-0 |
| C_ID |
C00045006
, 
|
| InChIKey |
ODFGLJQOCBLUPX-QQANTVPENA-N |
| InChICode |
InChI=1S/C28H40O7/c1-14-12-21(34-23(31)15(14)2)26(5,32)27(33)11-9-17-16-13-22-28(35-22)20(30)7-6-19(29)25(28,4)18(16)8-10-24(17,27)3/h6-7,14-18,20-22,30,32-33H,8-13H2,1-5H3/t14-,15+,16-,17-,18-,20-,21+,22+,24-,25-,26-,27+,28+/m0/s1 |
| SMILES |
C[C@H]1C[C@H]([C@](C)(O)[C@@]2(O)CC[C@H]3[C@@H]4C[C@H]5O[C@]56[C@@H](O)C=CC(=O)[C@]6(C)[C@H]4CC[C@@]32C)OC(=O)[C@@H]1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Deprea subtriflora | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
|
|
zoom in
| Organism | Withania somnifera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|