| Name |
Latisxanthone C |
| Formula |
C28H30O6 |
| Mw |
462.20423869 |
| CAS RN |
197447-32-8 |
| C_ID |
C00044854
, 
|
| InChIKey |
PZWBBMGLWODZNF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C28H30O6/c1-14(2)7-9-17-21(29)18(10-8-15(3)4)26-20(22(17)30)23(31)19-13-16-11-12-28(5,6)34-25(16)24(32)27(19)33-26/h7-8,11-13,29-30,32H,9-10H2,1-6H3 |
| SMILES |
CC(C)=CCc1c(O)c(CC=C(C)C)c2oc3c(O)c4c(cc3c(=O)c2c1O)C=CC(C)(C)O4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum brasiliensis | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia assigu | Ref. |
|
|
zoom in
| Organism | Garcinia assigu | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|