| Name |
Fuscaxanthone B |
| Formula |
C29H34O7 |
| Mw |
494.23045344 |
| CAS RN |
499777-92-3 |
| C_ID |
C00044769
, 
|
| InChIKey |
SZJVILSJACSJTP-MHWRWJLKNA-N |
| InChICode |
InChI=1S/C29H34O7/c1-15(2)8-7-9-16(3)10-11-17-24-21(13-19(30)28(17)34-6)35-22-14-20-18(26(32)25(22)27(24)33)12-23(31)29(4,5)36-20/h8,10,13-14,23,30-32H,7,9,11-12H2,1-6H3/b16-10+/t23-/m0/s1 |
| SMILES |
COc1c(O)cc2oc3cc4c(c(O)c3c(=O)c2c1C/C=C(C)CCC=C(C)C)CC(O)C(C)(C)O4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia fusca | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
|
|
zoom in
| Organism | Garcinia schomburgkiana | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|