| Name |
Catuabine G |
| Formula |
C16H21NO5 |
| Mw |
307.14197279 |
| CAS RN |
526217-20-9 |
| C_ID |
C00044620
, 
|
| InChIKey |
SVTKQUPFOUSWAL-NQPNPBMCNA-N |
| InChICode |
InChI=1S/C16H21NO5/c1-17-12-7-11(8-13(17)16(21)15(12)20)22-14(19)6-9-3-2-4-10(18)5-9/h2-5,11-13,15-16,18,20-21H,6-8H2,1H3/t11-,12-,13+,15-,16+ |
| SMILES |
CN1[C@@H]2C[C@@H](OC(=O)Cc3cccc(O)c3)C[C@H]1[C@H](O)[C@@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum vacciniifolium | Ref. |
| - | - | Erythroxylon vacciniifolium | Ref. |
|
|
zoom in
| Organism | Erythroxylon vacciniifolium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|