| Name |
Catuabine F
(-)-Catuabine F |
| Formula |
C23H28N2O7 |
| Mw |
444.18965126 |
| CAS RN |
526217-18-5 |
| C_ID |
C00044619
, 
|
| InChIKey |
FDOGTDAJEOKOQD-AQCHAGEYNA-N |
| InChICode |
InChI=1S/C23H28N2O7/c1-24-7-5-6-16(24)23(28)32-18-11-14-10-15(12-17(18)25(14)2)31-22(27)13-8-19(29-3)21(26)20(9-13)30-4/h5-9,14-15,17-18,26H,10-12H2,1-4H3/t14-,15-,17+,18-/m1/s1 |
| SMILES |
COc1cc(C(=O)O[C@@H]2C[C@@H]3C[C@@H](OC(=O)c4cccn4C)[C@H](C2)N3C)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum vacciniifolium | Ref. |
| - | - | Erythroxylon vacciniifolium | Ref. |
|
|
zoom in
| Organism | Erythroxylon vacciniifolium |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
