| Name |
Catuabine E (-)-Catuabine E |
| Formula |
C20H25N3O4 |
| Mw |
371.18450631 |
| CAS RN |
526217-13-0 |
| C_ID |
C00044618
, 
|
| InChIKey |
VLUBVMQZRACLJZ-OMEUXEOGNA-N |
| InChICode |
InChI=1S/C20H25N3O4/c1-21-8-4-6-15(21)19(24)26-14-10-13-11-18(17(12-14)23(13)3)27-20(25)16-7-5-9-22(16)2/h4-9,13-14,17-18H,10-12H2,1-3H3/t13-,14-,17+,18-/m1/s1 |
| SMILES |
CN1[C@@H]2C[C@@H](OC(=O)c3cccn3C)C[C@H]1[C@H](OC(=O)c1cccn1C)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum vacciniifolium | Ref. |
| - | - | Erythroxylon vacciniifolium | Ref. |
|
|
zoom in
| Organism | Erythroxylon vacciniifolium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|