| Name |
beta-Amyrenone beta-Amyrone |
| Formula |
C30H48O |
| Mw |
424.37051615 |
| CAS RN |
638-97-1 |
| C_ID |
C00044566
, 
|
| InChIKey |
LIIFBMGUDSHTOU-POTFCNDINA-N |
| InChICode |
InChI=1S/C30H48O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h9,21-23H,10-19H2,1-8H3/t21-,22-,23+,27+,28-,29+,30+/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio chionophilus | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Meliaceae | Ekebergia pterophylla | Ref. |
| Plantae | Rutaceae | Zanthoxylum acanthopodium DC.  | Ref. |
|
|
zoom in
| Organism | Terminalia brasiliensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|