| Name |
7beta-Hydroxycatuabine D |
| Formula |
C19H23N3O5 |
| Mw |
373.16377087 |
| CAS RN |
526217-11-8 |
| C_ID |
C00044480
, 
|
| InChIKey |
RJIOYVYRNVCWLC-RHPQMTLYNA-N |
| InChICode |
InChI=1S/C19H23N3O5/c1-21-8-4-6-13(21)19(25)26-11-9-14-16(23)17(15(10-11)22(14)2)27-18(24)12-5-3-7-20-12/h3-8,11,14-17,20,23H,9-10H2,1-2H3/t11-,14+,15-,16-,17+/m1/s1 |
| SMILES |
CN1[C@@H]2C[C@@H](OC(=O)c3cccn3C)C[C@H]1[C@H](OC(=O)c1ccc[nH]1)[C@@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum vacciniifolium | Ref. |
| - | - | Erythroxylon vacciniifolium | Ref. |
|
|
zoom in
| Organism | Erythroxylon vacciniifolium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|