| Name |
4-Hydroxy-5-methylcoumarin 4-O-beta-D-glucopyranoside Gerberinside |
| Formula |
C16H18O8 |
| Mw |
338.10016755 |
| CAS RN |
76474-54-9 |
| C_ID |
C00044063
, 
|
| InChIKey |
DXBGTODWNFZHCD-FOJDLPTENA-N |
| InChICode |
InChI=1S/C16H18O8/c1-7-3-2-4-8-12(7)9(5-11(18)22-8)23-16-15(21)14(20)13(19)10(6-17)24-16/h2-5,10,13-17,19-21H,6H2,1H3/t10-,13-,14+,15-,16-/m1/s1 |
| SMILES |
Cc1cccc2oc(=O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ethulia conyzoides | Ref. |
| Plantae | Asteraceae | Gerbera anandria | Ref. |
|
|
zoom in
| Organism | Gerbera anandria | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001). |
|---|
|