| Name |
Speedoside |
| Formula |
C30H38O18 |
| Mw |
686.20581441 |
| CAS RN |
219787-02-7 |
| C_ID |
C00043019
, 
|
| InChIKey |
ANEVGLDJVAGIAL-XIZYATIWNA-N |
| InChICode |
InChI=1S/C30H38O18/c31-8-15-19(36)21(38)23(40)28(44-15)43-14-3-1-11(7-13(14)34)2-4-17(35)46-25-12-5-6-42-27(18(12)30(10-33)26(25)48-30)47-29-24(41)22(39)20(37)16(9-32)45-29/h1-7,12,15-16,18-29,31-34,36-41H,8-10H2/b4-2+/t12-,15+,16+,18+,19+,20+,21-,22-,23+,24+,25-,26-,27-,28+,29-,30+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c1)O[C@H]1[C@@H]2C=CO[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2[C@@]2(CO)O[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Veronica bellidioides | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
|
|
zoom in
| Organism | Veronica montana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|