| Name |
Bufalin |
| Formula |
C24H34O4 |
| Mw |
386.24570957 |
| CAS RN |
465-21-4 |
| C_ID |
C00042323
, 
|
| InChIKey |
QEEBRPGZBVVINN-WAKBTOJMNA-N |
| InChICode |
InChI=1S/C24H34O4/c1-22-10-7-17(25)13-16(22)4-5-20-19(22)8-11-23(2)18(9-12-24(20,23)27)15-3-6-21(26)28-14-15/h3,6,14,16-20,25,27H,4-5,7-13H2,1-2H3/t16-,17+,18-,19+,20-,22+,23-,24+/m1/s1 |
| SMILES |
C[C@]12CC[C@H](O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3ccc(=O)oc3)CC[C@]12O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Cunninghamellaceae | Cunninghamella blakesleana | Ref. |
| Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
|
|
zoom in
| Organism | Bryophyllum pinnatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|