| Name |
5-Methoxycanthin-6-one |
| Formula |
C15H10N2O2 |
| Mw |
250.07422758 |
| CAS RN |
15071-56-4 |
| C_ID |
C00042154
, 
|
| InChIKey |
TXEFUSAHPIYZHD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10N2O2/c1-19-13-8-11-14-10(6-7-16-11)9-4-2-3-5-12(9)17(14)15(13)18/h2-8H,1H3 |
| SMILES |
COc1cc2nccc3c4ccccc4n(c1=O)c23 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Zanthoxylum chiloperone var. angustifolium | Ref. |
| Plantae | Simaroubaceae | Eurycoma longifolia  | Ref. |
| Plantae | Simaroubaceae | Eurycoma longifolida | Ref. |
| Plantae | Simaroubaceae | Picrasma excelsa  | Ref. |
|
|
zoom in
| Organism | Eurycoma longifolia | | Reference | Guo, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 16, (2005), 88.
Kuo, et al., Journal of Natural Products, 66, (2003), 1324 |
|---|
|