| Name |
Ocotillol (20S,24R)-Epoxydammarane-3beta,25-diol |
| Formula |
C30H52O3 |
| Mw |
460.39164553 |
| CAS RN |
5986-39-0 |
| C_ID |
C00042003
, 
|
| InChIKey |
RQBNSDSKUAGBOI-ZDKUSFMDNA-N |
| InChICode |
InChI=1S/C30H52O3/c1-25(2)21-12-17-29(7)22(27(21,5)15-13-23(25)31)10-9-19-20(11-16-28(19,29)6)30(8)18-14-24(33-30)26(3,4)32/h19-24,31-32H,9-18H2,1-8H3/t19-,20+,21+,22-,23+,24-,27+,28-,29-,30+/m1/s1 |
| SMILES |
CC(C)(O)[C@H]1CC[C@@](C)([C@H]2CC[C@]3(C)[C@@H]2CC[C@@H]2[C@@]4(C)CC[C@H](O)C(C)(C)[C@@H]4CC[C@]23C)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Betulaceae | Betula platyphylla var. japonica | Ref. |
|
|
zoom in
| Organism | Panax ginseng | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|