| Name |
3'-Hydroxyacetophenone |
| Formula |
C8H8O2 |
| Mw |
136.0524295 |
| CAS RN |
121-17-1 |
| C_ID |
C00040821
, 
|
| InChIKey |
LUJMEECXHPYQOF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O2/c1-6(9)7-3-2-4-8(10)5-7/h2-5,10H,1H3 |
| SMILES |
CC(=O)c1cccc(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Citrus sinensis cv.Valencia  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|