| Name |
Toxyloxanthone A Trapezifolixanthone |
| Formula |
C23H22O5 |
| Mw |
378.14672381 |
| CAS RN |
50816-23-4 |
| C_ID |
C00040543
, 
|
| InChIKey |
YWHROXVOOAEFOY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H22O5/c1-12(2)8-9-15-20-14(10-11-23(3,4)28-20)19(26)17-18(25)13-6-5-7-16(24)21(13)27-22(15)17/h5-8,10-11,24,26H,9H2,1-4H3 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c(=O)c4cccc(O)c4oc13)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia tetralata | Ref. |
| Plantae | Clusiaceae-Guttiferae | Tovomita brevistaminea | Ref. |
|
|
zoom in
| Organism | Garcinia tetralata | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|