| Name |
Shizukanolide F |
| Formula |
C15H18O4 |
| Mw |
262.12050906 |
| CAS RN |
120061-96-3 |
| C_ID |
C00040293
, 
|
| InChIKey |
ULWLTEZXDAFDPV-KNHDLZQINA-N |
| InChICode |
InChI=1S/C15H18O4/c1-15-4-13-8(10(6-17)14(18)19-13)3-12(15)9(5-16)7-2-11(7)15/h4,7,9,11-12,16-17H,2-3,5-6H2,1H3/t7-,9-,11-,12+,15-/m1/s1 |
| SMILES |
C[C@@]12C=C3OC(=O)C(CO)=C3C[C@H]1[C@H](CO)[C@H]1C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chloranthaceae | Chloranthus japonicus | Ref. |
| Plantae | Chloranthaceae | Chloranthus serratus | Ref. |
| Plantae | Chloranthaceae | Chloranthus spicatus | Ref. |
|
|
zoom in
| Organism | Chloranthus serratus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|