| Name |
Jasminoside A (-)-Jasminoside A |
| Formula |
C16H26O7 |
| Mw |
330.16785319 |
| CAS RN |
214125-03-8 |
| C_ID |
C00039485
, 
|
| InChIKey |
FOONTNRMWNJWCL-VCKBDVEJNA-N |
| InChICode |
InChI=1S/C16H26O7/c1-8-4-9(18)5-16(2,3)10(8)7-22-15-14(21)13(20)12(19)11(6-17)23-15/h4,10-15,17,19-21H,5-7H2,1-3H3/t10-,11+,12-,13-,14+,15+/m0/s1 |
| SMILES |
CC1=CC(=O)CC(C)(C)[C@H]1CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Gardenia jasminoides  | Ref. |
| Plantae | Solanaceae | Solanum jasminoides | Ref. |
|
|
zoom in
| Organism | Solanum jasminoides | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|