| Name |
Harpagoside B (-)-Harpagoside B |
| Formula |
C25H32O11 |
| Mw |
508.19446187 |
| CAS RN |
620609-57-6 |
| C_ID |
C00039336
, 
|
| InChIKey |
BEHDYQAAWZWDFR-IBXSQOMPNA-N |
| InChICode |
InChI=1S/C25H32O11/c1-24(36-17(27)9-8-14-6-4-3-5-7-14)12-16(32-2)25(31)10-11-33-23(21(24)25)35-22-20(30)19(29)18(28)15(13-26)34-22/h3-11,15-16,18-23,26,28-31H,12-13H2,1-2H3/b9-8+/t15-,16-,18-,19+,20-,21+,22+,23+,24+,25+/m1/s1 |
| SMILES |
CO[C@@H]1C[C@](C)(OC(=O)/C=C/c2ccccc2)[C@@H]2[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C[C@]21O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia deserti  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia oxysepala | Ref. |
|
|
zoom in
| Organism | Scrophularia oxysepala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|