| Name |
Guttiferone K |
| Formula |
C38H50O6 |
| Mw |
602.36073933 |
| CAS RN |
929695-89-6 |
| C_ID |
C00039303
, 
|
| InChIKey |
QKKRBNPMUBNTPA-GIMZVPJONA-N |
| InChICode |
InChI=1S/C38H50O6/c1-23(2)11-10-18-36(9)28(14-12-24(3)4)22-37(19-16-25(5)6)33(42)31(32(41)27-13-15-29(39)30(40)21-27)34(43)38(36,35(37)44)20-17-26(7)8/h11-13,15-17,21,28,39-40,42H,10,14,18-20,22H2,1-9H3/t28-,36+,37+,38-/m1/s1 |
| SMILES |
CC(C)=CCC[C@@]1(C)[C@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)[C@@]1(CC=C(C)C)C(=O)C(C(=O)c1ccc(O)c(O)c1)=C2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae | Rheedia calcicola | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia gummi-gutta | Ref. |
|
|
zoom in
| Organism | Garcinia gummi-gutta | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|