| Name |
Dulxanthone E |
| Formula |
C22H22O7 |
| Mw |
398.13655306 |
| CAS RN |
261896-23-5 |
| C_ID |
C00039053
, 
|
| InChIKey |
DLIXREHRECIYQJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H22O7/c1-22(2)10-9-12-16(25-4)14-15(23)11-7-8-13(24-3)19(26-5)17(11)28-20(14)21(27-6)18(12)29-22/h7-10H,1-6H3 |
| SMILES |
COc1ccc2c(=O)c3c(OC)c4c(c(OC)c3oc2c1OC)OC(C)(C)C=C4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia porrecta | Ref. |
|
|
zoom in
| Organism | Garcinia porrecta |
|---|
| Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|
