| Name |
Crypthophilic acid B (-)-Crypthophilic acid B |
| Formula |
C45H80O23 |
| Mw |
988.50903886 |
| CAS RN |
924886-63-5 |
| C_ID |
C00038870
, 
|
| InChIKey |
ANAGMXSUOWSSPU-GYKJDKJQNA-N |
| InChICode |
InChI=1S/C45H80O23/c1-6-8-16-25(17-14-12-10-9-11-13-15-24(47)18-28(48)49)63-44-39(34(55)31(52)27(65-44)20-60-42-36(57)32(53)29(50)22(4)61-42)68-45-40(33(54)30(51)26(19-46)64-45)67-43-37(58)35(56)38(23(5)62-43)66-41(59)21(3)7-2/h21-27,29-40,42-47,50-58H,6-20H2,1-5H3,(H,48,49)/t21-,22-,23-,24+,25-,26+,27+,29-,30+,31+,32+,33-,34-,35-,36+,37+,38-,39+,40+,42+,43-,44+,45-/m0/s1 |
| SMILES |
CCCC[C@@H](CCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@H](OC(=O)C(C)CC)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia crypthophila  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia cryptophila | Ref. |
|
|
zoom in
| Organism | Scrophularia cryptophila | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|