| Name |
Crypthophilic acid A (-)-Crypthophilic acid A |
| Formula |
C40H72O22 |
| Mw |
904.45152399 |
| CAS RN |
925424-87-9 |
| C_ID |
C00038869
, 
|
| InChIKey |
JWKIOWGQARSDFT-WUOVEUKINA-N |
| InChICode |
InChI=1S/C40H72O22/c1-4-5-13-21(14-11-9-7-6-8-10-12-20(42)15-24(43)44)58-39-35(32(52)28(48)23(60-39)17-55-37-33(53)29(49)25(45)18(2)56-37)62-40-36(31(51)27(47)22(16-41)59-40)61-38-34(54)30(50)26(46)19(3)57-38/h18-23,25-42,45-54H,4-17H2,1-3H3,(H,43,44)/t18-,19-,20+,21-,22+,23+,25-,26-,27-,28-,29+,30+,31-,32-,33+,34+,35+,36+,37+,38-,39+,40-/m0/s1 |
| SMILES |
CCCC[C@@H](CCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia crypthophila  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia cryptophila | Ref. |
|
|
zoom in
| Organism | Scrophularia cryptophila | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|