| Name |
7-Epiclusianone 7-epi-Clusianone |
| Formula |
C33H42O4 |
| Mw |
502.30830983 |
| CAS RN |
250275-46-8 |
| C_ID |
C00038318
, 
|
| InChIKey |
JXKKYQPCNJMAHZ-JEOBOIONNA-N |
| InChICode |
InChI=1S/C33H42O4/c1-21(2)14-15-25-20-32(18-16-22(3)4)28(35)26(27(34)24-12-10-9-11-13-24)29(36)33(30(32)37,31(25,7)8)19-17-23(5)6/h9-14,16-17,25,35H,15,18-20H2,1-8H3/t25-,32-,33+/m1/s1 |
| SMILES |
CC(C)=CC[C@@H]1CC2(CC=C(C)C)C(=O)C(CC=C(C)C)(C(=O)C(C(=O)c3ccccc3)=C2O)C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae | Rheedia gardneriana  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia brasiliensis  | Ref. |
| Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
| Plantae | Hypericaceae | Hypericum scabrum  | Ref. |
|
|
zoom in
| Organism | Garcinia brasiliensis | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|