| Name |
6-O-Veratroylcatalpol |
| Formula |
C24H30O13 |
| Mw |
526.16864105 |
| CAS RN |
56973-43-4 |
| C_ID |
C00038309
, 
|
| InChIKey |
JPLOCWOFCUFHBG-AFSFDAEYNA-N |
| InChICode |
InChI=1S/C24H30O13/c1-31-12-4-3-10(7-13(12)32-2)21(30)35-19-11-5-6-33-22(15(11)24(9-26)20(19)37-24)36-23-18(29)17(28)16(27)14(8-25)34-23/h3-7,11,14-20,22-23,25-29H,8-9H2,1-2H3/t11-,14+,15+,16+,17-,18+,19-,20-,22-,23-,24+/m0/s1 |
| SMILES |
COc1ccc(C(=O)O[C@H]2[C@@H]3C=CO[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H]3[C@@]3(CO)O[C@@H]23)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Veronica cymbalaria | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
|
|
zoom in
| Organism | Veronica persica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|