| Name |
2,5-Dimethyl-7-hydroxychromone |
| Formula |
C11H10O3 |
| Mw |
190.06299419 |
| CAS RN |
38412-47-4 |
| C_ID |
C00038203
, 
|
| InChIKey |
CRNGFKXWIYTEPH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H10O3/c1-6-3-8(12)5-10-11(6)9(13)4-7(2)14-10/h3-5,12H,1-2H3 |
| SMILES |
Cc1cc(=O)c2c(C)cc(O)cc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Dothideomycetes | Alternaria sp. | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
| Plantae | Polygonaceae | Rheum sp. | Ref. |
|
|
zoom in
| Organism | Plumbago zeylanica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|